Target Relevance

Molecular Definition

Canonical SMILES ClC1=C(CCC2CCCCC2)C=CC(=O)O1
Formula C13H17ClO2
Molecular Weight 240.73 da
Stereocenters 0/0