Molecular Definition

Canonical SMILES CO\N=C(/C#N)\C12CCCN(CC1)C2
Formula C10H15N3O
Molecular Weight 193.25 da
Stereocenters 0/1