Molecular Definition

Canonical SMILES CCCCC(=O)NCCC1CCc2ccc(OC)cc12
Formula C17H25NO2
Molecular Weight 275.39 da
Stereocenters 0/1