Target Relevance

Molecular Definition

Canonical SMILES CC(C)(C(CCc1ccccc1)NC(=O)c2ccccc2)C(=O)OC(=O)C(C)(C)C(CCc3ccccc3)NC(=O)c4ccccc4
Formula C40H44N2O5
Molecular Weight 632.79 da
Stereocenters 0/2