Molecular Definition

Canonical SMILES CC(=O)OC1CCC2(C)C3CCC4(C)C(CC5CCCCC45C(=O)C)C3CC(=O)[C@@]2(O)C1
Formula C27H40O5
Molecular Weight 444.60 da
Stereocenters 1/9