Target Relevance

Molecular Definition

Canonical SMILES CCCC1=NN(C)C2=NC(=O)N(C)C(=O)C2=N1
Formula C10H13N5O2
Molecular Weight 235.24 da
Stereocenters 0/0