Target Relevance

Molecular Definition

Canonical SMILES CCO[C@H]1OC(=C[C@H]([C@@H]1CCCO)c2csc3ccccc23)C(=O)Nc4ccccc4
Formula C25H27NO4S
Molecular Weight 437.55 da
Stereocenters 3/3