Molecular Definition

Canonical SMILES COc1ccccc1N2CCN(Cc3cccc(CNC(=O)c4ccc5ccccc5c4)c3)CC2.OC(=O)C(=O)O
Formula C32H33N3O6
Molecular Weight 555.62 da
Stereocenters 0/0