Molecular Definition

Canonical SMILES CC(C)Oc1cccc(NC(=O)c2cncc(n2)c3ccc(cc3)C#N)c1
Formula C21H18N4O2
Molecular Weight 358.39 da
Stereocenters 0/0