Molecular Definition

Canonical SMILES COc1cc(NC(=O)c2cncc(n2)c3ccc(Cl)cc3)cc(OC)c1
Formula C19H16ClN3O3
Molecular Weight 369.80 da
Stereocenters 0/0