Molecular Definition

Canonical SMILES CCCc1c(O)c(O)c(C(=O)O)c2ccc(C)cc12
Formula C15H16O4
Molecular Weight 260.29 da
Stereocenters 0/0