Target Relevance

Molecular Definition

Canonical SMILES Fc1ccc(cc1)C(=O)OCC#CCSc2oc(nn2)c3occc3
Formula C17H11FN2O4S
Molecular Weight 358.34 da
Stereocenters 0/0