Target Relevance

Molecular Definition

Canonical SMILES O=C(OCC#CCSc1oc(nn1)c2cccc3ccccc23)c4c[nH]cn4
Formula C20H14N4O3S
Molecular Weight 390.42 da
Stereocenters 0/0