Target Relevance

Molecular Definition

Canonical SMILES NC(=S)N\N=C(/c1cccnc1)\c2cccc(Br)c2
Formula C13H11BrN4S
Molecular Weight 335.22 da
Stereocenters 0/0