Molecular Definition

Canonical SMILES CCCc1c(O)c(O)c(C(=O)O)c2cc(Cc3ccccc3)c(C)cc12
Formula C22H22O4
Molecular Weight 350.41 da
Stereocenters 0/0