Molecular Definition

Canonical SMILES CC(=O)NCCCc1cccc2nc(oc12)c3ccccc3
Formula C18H18N2O2
Molecular Weight 294.35 da
Stereocenters 0/0