Molecular Definition

Canonical SMILES CN(Cc1ccccc1)c2nc3sc4c(NCCN5CCOCC5)ncnc4c3c6CC(C)(C)CCc26
Formula C29H36N6OS
Molecular Weight 516.70 da
Stereocenters 0/0