Molecular Definition

Canonical SMILES OC(CNC1CCN(CC1)c2ncnc3scc(c4ccccc4)c23)COc5ccc(F)cc5
Formula C26H27FN4O2S
Molecular Weight 478.58 da
Stereocenters 0/1