Target Relevance

Molecular Definition

Canonical SMILES Cc1c(sc2ncnc(N3CCC(CC3)NCC(O)COc4ccc(O)c(CO)c4)c12)c5ccccc5
Formula C28H32N4O4S
Molecular Weight 520.64 da
Stereocenters 0/1