Molecular Definition

Canonical SMILES Cc1c(sc2ncnc(N3CCC(CC3)NCC(O)COc4ccccc4)c12)c5ccccc5
Formula C27H30N4O2S
Molecular Weight 474.62 da
Stereocenters 0/1