Molecular Definition

Canonical SMILES CC(N)Cc1c[nH]c2ccc(OCc3cccs3)cc12
Formula C16H18N2OS
Molecular Weight 286.39 da
Stereocenters 0/1