Target Relevance

Molecular Definition

Canonical SMILES O=C(CN(c1ccccc1)S(=O)(=O)c2ccccc2)N\N=C\3/C(=O)Nc4ccccc34
Formula C22H18N4O4S
Molecular Weight 434.47 da
Stereocenters 0/0