Molecular Definition

Canonical SMILES COc1ccc(cc1)S(=O)(=O)N2CCN(CC2C(=O)NO)C(=O)c3cccnc3
Formula C18H20N4O6S
Molecular Weight 420.44 da
Stereocenters 0/1