Target Relevance

Molecular Definition

Canonical SMILES O[C@@H](CNCCc1ccc(N\C(=N\c2cccc(F)c2)\NC#N)cc1)c3cccnc3
Formula C23H23FN6O
Molecular Weight 418.47 da
Stereocenters 1/1