Molecular Definition

Canonical SMILES OB(O)[C@@H]1CCCN1C(=O)[C@@H]2C[C@@H](CC(=O)N3Cc4ccccc4C3)C(=O)N2
Formula C19H24BN3O5
Molecular Weight 385.22 da
Stereocenters 3/3