Target Relevance

Molecular Definition

Canonical SMILES O=C(C[C@@H]1C[C@H](NC1=O)C(=O)N2CCC[C@H]2C#N)N3CCCCC3
Formula C17H24N4O3
Molecular Weight 332.40 da
Stereocenters 3/3