Target Relevance

Molecular Definition

Canonical SMILES Fc1ccc(cc1)N2CCN(CC2)C(=O)C[C@@H]3C[C@H](NC3=O)C(=O)N4CCC[C@H]4C#N
Formula C22H26FN5O3
Molecular Weight 427.47 da
Stereocenters 3/3