Molecular Definition

Canonical SMILES CCOC(=O)CCN(C(=O)c1ccc2c(c1)nc(CNc3ccc(cc3)C(=N)N)n2C)c4ccccn4
Formula C27H29N7O3
Molecular Weight 499.56 da
Stereocenters 0/0