Molecular Definition

Canonical SMILES N[C@@H](CN1C=C(F)C(=O)NC1=O)C(=O)O
Formula C7H8FN3O4
Molecular Weight 217.15 da
Stereocenters 1/1