Molecular Definition

Canonical SMILES N[C@@H](CN1N=CC(=O)NC1=O)C(=O)O
Formula C6H8N4O4
Molecular Weight 200.15 da
Stereocenters 1/1