Molecular Definition

Canonical SMILES C[C@@H](O)[C@@H](CO)NC(=O)[C@@H]1C\C=C/C[C@H](NC(=O)[C@H](N)Cc2ccccc2)C(=O)N[C@@H](Cc3cccc4ccccc34)C(=O)N[C@H](Cc5cc6ccccc6[nH]5)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](Cc7ccc(OC(=O)c8ccccc8)cc7)C(=O)N1
Formula C67H76N10O11
Molecular Weight 1197.38 da
Stereocenters 9/9