Molecular Definition

Canonical SMILES CC(C)N(c1cccc(c1)N2CCN(C)CC2)S(=O)(=O)c3cccc4ccccc34
Formula C24H29N3O2S
Molecular Weight 423.57 da
Stereocenters 0/0