Molecular Definition

Canonical SMILES CC[C@H](C)[C@@H](CO[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCS(=O)(=O)C)C(=O)OC(C)C)NC[C@@H](N)CS
Formula C26H45N3O6S2
Molecular Weight 559.78 da
Stereocenters 5/5