Molecular Definition

Canonical SMILES N[C@@H](CN1C=CC(=O)NC1=O)C(=O)O
Formula C7H9N3O4
Molecular Weight 199.16 da
Stereocenters 1/1