Molecular Definition

Canonical SMILES N[C@@H](CN1N=C(I)C(=O)NC1=O)C(=O)O
Formula C6H7IN4O4
Molecular Weight 326.05 da
Stereocenters 1/1