Molecular Definition

Canonical SMILES N[C@@H](CN1C=C(Cl)C(=O)NC1=O)C(=O)O
Formula C7H8ClN3O4
Molecular Weight 233.61 da
Stereocenters 1/1