Target Relevance

Molecular Definition

Canonical SMILES Cc1c(CC23C[C@@H]4C[C@@H](C[C@@H](C4)C2)C3)n5cccc(OCC(=O)O)c5c1C(=O)C(=O)N
Formula C24H28N2O5
Molecular Weight 424.49 da
Stereocenters 3/3