Molecular Definition

Canonical SMILES CCCN(CCC)c1cc(CC)nc2c(c(C)nn12)c3ccc(Cl)cc3
Formula C21H27ClN4
Molecular Weight 370.92 da
Stereocenters 0/0