Molecular Definition

Canonical SMILES COc1c(NC(=O)C(=O)c2ccc(OCCN3CCOCC3)c4ccccc24)cc(cc1NS(=O)(=O)C)C(C)(C)C
Formula C30H37N3O7S
Molecular Weight 583.70 da
Stereocenters 0/0