Target Relevance

Molecular Definition

Canonical SMILES Cl.C1C2CC3CC1CC(C2)C34NC(Cc5c4[nH]c6ccccc56)c7nc(c[nH]7)c8ccccc8
Formula C29H31ClN4
Molecular Weight 471.04 da
Stereocenters 0/1