Molecular Definition

Canonical SMILES Cl.COc1cc2c(Nc3cc(O)c(C)cc3F)ncnc2cc1OCC4CCN(C)CC4
Formula C23H28ClFN4O3
Molecular Weight 462.95 da
Stereocenters 0/0