Target Relevance

Molecular Definition

Canonical SMILES CCc1c(Cc2ccccc2[N+](=O)[O-])n3cccc(OCC(=O)O)c3c1C(=O)C(=O)N
Formula C21H19N3O7
Molecular Weight 425.39 da
Stereocenters 0/0