Target Relevance

Molecular Definition

Canonical SMILES COc1ccc(cc1)[C@H](NC[C@H](O)c2ccc(O)c(NS(=O)(=O)C)c2)C(=O)Nc3ccc(Cl)cc3
Formula C24H26ClN3O6S
Molecular Weight 520.00 da
Stereocenters 2/2