Molecular Definition

Canonical SMILES [Cl-].CC(C)C[C@H](NC(=O)[C@@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H]2CCCN2C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](C)CCC[N+](C)(C)C)C(C)(C)C)C(=O)O
Formula C41H70ClN9O8
Molecular Weight 852.50 da
Stereocenters 6/7