Molecular Definition

Canonical SMILES CCN(C(=O)C)c1ccc(OC)c2nc(NC(=O)c3ccc(cc3)C(=O)N4CCCCC4)sc12
Formula C25H28N4O4S
Molecular Weight 480.58 da
Stereocenters 0/0