Molecular Definition

Canonical SMILES CC(C)CCC[C@@](C)(O)[C@H]1CC[C@H]2[C@@H]3C[C@H](O[C@@H]4O[C@H](C)[C@@H](O)[C@H](O[C@@H]5OC[C@@H](O[C@@H]6O[C@H](C)[C@@H](O[C@@H]7OC[C@H](O)[C@H](O)[C@H]7O)[C@H](O)[C@H]6O[C@@H]8O[C@H](C)[C@H](O)[C@H](O)[C@H]8O)[C@H](O)[C@H]5O[C@@H]9O[C@H](C)[C@@H](O)[C@H](O)[C@H]9O)[C@H]4O)[C@H]%10C[C@H](CC[C@]%10(C)C3=CC[C@]12C)OS(=O)(=O)O
Formula C61H102O30S
Molecular Weight 1347.51 da
Stereocenters 37/37