Molecular Definition

Canonical SMILES CCCC[C@H](NC(=O)O[C@H](Cc1ccccc1)C(C)C)C=O
Formula C18H27NO3
Molecular Weight 305.41 da
Stereocenters 2/2