Molecular Definition

Canonical SMILES C[C@H]([C@@H](O)c1ccc(O)cc1)N2CCC(Cc3ccccc3)CC2
Formula C21H27NO2
Molecular Weight 325.44 da
Stereocenters 2/2