Molecular Definition

Canonical SMILES Oc1ccc(cc1)C2=COc3cc(OCCCCBr)ccc3C2=O
Formula C19H17BrO4
Molecular Weight 389.24 da
Stereocenters 0/0