Molecular Definition

Canonical SMILES Oc1ccc(cc1)C2=COc3cc(OCCCCCCBr)ccc3C2=O
Formula C21H21BrO4
Molecular Weight 417.29 da
Stereocenters 0/0